C35H39N5O3 — CID 58043701
2-[2-(hydroxymethyl)-3-[4-methyl-5-oxo-6-[(4-piperidin-4-ylphenyl)methyl]pyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one (PubChem CID 58043701) has the molecular formula C35H39N5O3 and a molecular weight of 577.73 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-3-[4-methyl-5-oxo-6-[(4-piperidin-4-ylphenyl)methyl]pyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one.
| Compound Name | 2-[2-(hydroxymethyl)-3-[4-methyl-5-oxo-6-[(4-piperidin-4-ylphenyl)methyl]pyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 58043701 |
| Molecular Formula | C35H39N5O3 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | 2-[2-(hydroxymethyl)-3-[4-methyl-5-oxo-6-[(4-piperidin-4-ylphenyl)methyl]pyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
| SMILES | Cn1cc(-c2cccc(N3CCn4c(cc5c4CCCC5)C3=O)c2CO)nc(Cc2ccc(C3CCNCC3)cc2)c1=O |
| InChI | InChI=1S/C35H39N5O3/c1-38-21-30(37-29(34(38)42)19-23-9-11-24(12-10-23)25-13-15-36-16-14-25)27-6-4-8-32(28(27)22-41)40-18-17-39-31-7-3-2-5-26(31)20-33(39)35(40)43/h4,6,8-12,20-21,25,36,41H,2-3,5,7,13-19,22H2,1H3 |
| InChIKey | FTIZYOYWZSNWHF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |