About ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate
ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate (PubChem CID 58044109) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate.
Analyze ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate?
The IUPAC name of ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate (CID 58044109) is ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate.
What is the SMILES notation for ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate?
The canonical SMILES for ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate is CCOC(=O)C1=CC2=C(C1)CC(C)(C)C2.
What is the InChIKey of ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate?
The InChIKey is VCVFZALTQVFTOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-4-15-12(14)9-5-10-7-13(2,3)8-11(10)6-9/h5H,4,6-8H2,1-3H3.
What are the key properties of ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate?
ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate has a molecular weight of 206.28 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5,5-dimethyl-4,6-dihydro-1H-pentalene-2-carboxylate is sourced from PubChem (CID 58044109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).