C19H13N3O2 — CID 58044829
(3R)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2'-carbaldehyde (PubChem CID 58044829) has the molecular formula C19H13N3O2 and a molecular weight of 315.33 g/mol. Its IUPAC name is (3R)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2'-carbaldehyde.
| Compound Name | (3R)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2'-carbaldehyde |
|---|---|
| PubChem CID | 58044829 |
| Molecular Formula | C19H13N3O2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (3R)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,7'-6,8-dihydrocyclopenta[g]quinoline]-2'-carbaldehyde |
| SMILES | O=Cc1ccc2cc3c(cc2n1)C[C@@]1(C3)C(=O)Nc2ncccc21 |
| InChI | InChI=1S/C19H13N3O2/c23-10-14-4-3-11-6-12-8-19(9-13(12)7-16(11)21-14)15-2-1-5-20-17(15)22-18(19)24/h1-7,10H,8-9H2,(H,20,22,24)/t19-/m1/s1 |
| InChIKey | AZUKIFKSAYLCFE-LJQANCHMSA-N |
| XLogP | 2.43 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|