C32H33N3O5 — CID 58044875
(4Z)-5-cyclohexyl-4-[hydroxy-[4-(piperidine-1-carbonyl)phenyl]methylidene]-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione (PubChem CID 58044875) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is (4Z)-5-cyclohexyl-4-[hydroxy-[4-(piperidine-1-carbonyl)phenyl]methylidene]-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-cyclohexyl-4-[hydroxy-[4-(piperidine-1-carbonyl)phenyl]methylidene]-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 58044875 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (4Z)-5-cyclohexyl-4-[hydroxy-[4-(piperidine-1-carbonyl)phenyl]methylidene]-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(-c3ccon3)cc2)C(C2CCCCC2)/C1=C(/O)c1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C32H33N3O5/c36-29(23-9-11-24(12-10-23)31(38)34-18-5-2-6-19-34)27-28(22-7-3-1-4-8-22)35(32(39)30(27)37)25-15-13-21(14-16-25)26-17-20-40-33-26/h9-17,20,22,28,36H,1-8,18-19H2/b29-27- |
| InChIKey | WKVCNAZALGMJDE-OHYPFYFLSA-N |
| XLogP | 5.80 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|