C26H31NO5 — CID 58047317
ethyl 3-oxo-3-[1-[6-[2-(4-propoxyphenyl)ethyl]-1-benzofuran-2-yl]ethylamino]propanoate (PubChem CID 58047317) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl 3-oxo-3-[1-[6-[2-(4-propoxyphenyl)ethyl]-1-benzofuran-2-yl]ethylamino]propanoate.
| Compound Name | ethyl 3-oxo-3-[1-[6-[2-(4-propoxyphenyl)ethyl]-1-benzofuran-2-yl]ethylamino]propanoate |
|---|---|
| PubChem CID | 58047317 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | ethyl 3-oxo-3-[1-[6-[2-(4-propoxyphenyl)ethyl]-1-benzofuran-2-yl]ethylamino]propanoate |
| SMILES | CCCOc1ccc(CCc2ccc3cc(C(C)NC(=O)CC(=O)OCC)oc3c2)cc1 |
| InChI | InChI=1S/C26H31NO5/c1-4-14-31-22-12-9-19(10-13-22)6-7-20-8-11-21-16-23(32-24(21)15-20)18(3)27-25(28)17-26(29)30-5-2/h8-13,15-16,18H,4-7,14,17H2,1-3H3,(H,27,28) |
| InChIKey | IKZLLCRNPYZMQK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|