C25H31NO5 — CID 67015773
tert-butyl-[1-[6-[(4-propoxyphenoxy)methyl]-1-benzofuran-2-yl]ethyl]carbamic acid (PubChem CID 67015773) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is tert-butyl-[1-[6-[(4-propoxyphenoxy)methyl]-1-benzofuran-2-yl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[1-[6-[(4-propoxyphenoxy)methyl]-1-benzofuran-2-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 67015773 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | tert-butyl-[1-[6-[(4-propoxyphenoxy)methyl]-1-benzofuran-2-yl]ethyl]carbamic acid |
| SMILES | CCCOc1ccc(OCc2ccc3cc(C(C)N(C(=O)O)C(C)(C)C)oc3c2)cc1 |
| InChI | InChI=1S/C25H31NO5/c1-6-13-29-20-9-11-21(12-10-20)30-16-18-7-8-19-15-22(31-23(19)14-18)17(2)26(24(27)28)25(3,4)5/h7-12,14-15,17H,6,13,16H2,1-5H3,(H,27,28) |
| InChIKey | SALCHEFQSDPXPM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |