C24H29NO4S — CID 67015910
tert-butyl-[1-[6-[(4-ethoxyphenoxy)methyl]-1-benzothiophen-2-yl]ethyl]carbamic acid (PubChem CID 67015910) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is tert-butyl-[1-[6-[(4-ethoxyphenoxy)methyl]-1-benzothiophen-2-yl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[1-[6-[(4-ethoxyphenoxy)methyl]-1-benzothiophen-2-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 67015910 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | tert-butyl-[1-[6-[(4-ethoxyphenoxy)methyl]-1-benzothiophen-2-yl]ethyl]carbamic acid |
| SMILES | CCOc1ccc(OCc2ccc3cc(C(C)N(C(=O)O)C(C)(C)C)sc3c2)cc1 |
| InChI | InChI=1S/C24H29NO4S/c1-6-28-19-9-11-20(12-10-19)29-15-17-7-8-18-14-21(30-22(18)13-17)16(2)25(23(26)27)24(3,4)5/h7-14,16H,6,15H2,1-5H3,(H,26,27) |
| InChIKey | QKPRCHOWRMOCID-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |