C22H27NO3S — CID 143982637
acetaldehyde;1-[6-[(4-ethoxyphenyl)methoxy]-1-benzothiophen-2-yl]-N-methylethanamine (PubChem CID 143982637) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is acetaldehyde;1-[6-[(4-ethoxyphenyl)methoxy]-1-benzothiophen-2-yl]-N-methylethanamine.
| Compound Name | acetaldehyde;1-[6-[(4-ethoxyphenyl)methoxy]-1-benzothiophen-2-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 143982637 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | acetaldehyde;1-[6-[(4-ethoxyphenyl)methoxy]-1-benzothiophen-2-yl]-N-methylethanamine |
| SMILES | CC=O.CCOc1ccc(COc2ccc3cc(C(C)NC)sc3c2)cc1 |
| InChI | InChI=1S/C20H23NO2S.C2H4O/c1-4-22-17-8-5-15(6-9-17)13-23-18-10-7-16-11-19(14(2)21-3)24-20(16)12-18;1-2-3/h5-12,14,21H,4,13H2,1-3H3;2H,1H3 |
| InChIKey | NDONZCDCWFBOBZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|