C20H20O5 — CID 58047621
2-[6-[(4-ethoxyphenyl)methoxy]-1-benzofuran-3-yl]propanoic acid (PubChem CID 58047621) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[6-[(4-ethoxyphenyl)methoxy]-1-benzofuran-3-yl]propanoic acid.
| Compound Name | 2-[6-[(4-ethoxyphenyl)methoxy]-1-benzofuran-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58047621 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[6-[(4-ethoxyphenyl)methoxy]-1-benzofuran-3-yl]propanoic acid |
| SMILES | CCOc1ccc(COc2ccc3c(C(C)C(=O)O)coc3c2)cc1 |
| InChI | InChI=1S/C20H20O5/c1-3-23-15-6-4-14(5-7-15)11-24-16-8-9-17-18(13(2)20(21)22)12-25-19(17)10-16/h4-10,12-13H,3,11H2,1-2H3,(H,21,22) |
| InChIKey | TUACBYKJKUSTLQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |