C21H23NO3S — CID 58047674
N-[1-[6-[(4-ethylsulfanylphenyl)methoxy]-1-benzofuran-3-yl]ethyl]acetamide (PubChem CID 58047674) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[1-[6-[(4-ethylsulfanylphenyl)methoxy]-1-benzofuran-3-yl]ethyl]acetamide.
| Compound Name | N-[1-[6-[(4-ethylsulfanylphenyl)methoxy]-1-benzofuran-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 58047674 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-[1-[6-[(4-ethylsulfanylphenyl)methoxy]-1-benzofuran-3-yl]ethyl]acetamide |
| SMILES | CCSc1ccc(COc2ccc3c(C(C)NC(C)=O)coc3c2)cc1 |
| InChI | InChI=1S/C21H23NO3S/c1-4-26-18-8-5-16(6-9-18)12-24-17-7-10-19-20(13-25-21(19)11-17)14(2)22-15(3)23/h5-11,13-14H,4,12H2,1-3H3,(H,22,23) |
| InChIKey | NYZVTZDOXVWZAR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |