C14H8Cl2N2OS — CID 58047690
2-(4,5-dichloro-1,3-benzothiazol-2-yl)-1-pyridin-3-ylethanone (PubChem CID 58047690) has the molecular formula C14H8Cl2N2OS and a molecular weight of 323.20 g/mol. Its IUPAC name is 2-(4,5-dichloro-1,3-benzothiazol-2-yl)-1-pyridin-3-ylethanone.
| Compound Name | 2-(4,5-dichloro-1,3-benzothiazol-2-yl)-1-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 58047690 |
| Molecular Formula | C14H8Cl2N2OS |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 2-(4,5-dichloro-1,3-benzothiazol-2-yl)-1-pyridin-3-ylethanone |
| SMILES | O=C(Cc1nc2c(Cl)c(Cl)ccc2s1)c1cccnc1 |
| InChI | InChI=1S/C14H8Cl2N2OS/c15-9-3-4-11-14(13(9)16)18-12(20-11)6-10(19)8-2-1-5-17-7-8/h1-5,7H,6H2 |
| InChIKey | IZMPRTVAGZDPTQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |