C22H18F3NO4 — CID 58051543
2-[[4-(3-ethoxyphenyl)-2-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxylic acid (PubChem CID 58051543) has the molecular formula C22H18F3NO4 and a molecular weight of 417.38 g/mol. Its IUPAC name is 2-[[4-(3-ethoxyphenyl)-2-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[4-(3-ethoxyphenyl)-2-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 58051543 |
| Molecular Formula | C22H18F3NO4 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[[4-(3-ethoxyphenyl)-2-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxylic acid |
| SMILES | CCOc1cccc(-c2ccc(Cc3ncccc3C(=O)O)c(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H18F3NO4/c1-2-29-17-6-3-5-14(11-17)15-8-9-16(20(13-15)30-22(23,24)25)12-19-18(21(27)28)7-4-10-26-19/h3-11,13H,2,12H2,1H3,(H,27,28) |
| InChIKey | IQGFOGHDJIPCQX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |