C10H14O5S2 — CID 58052946
4-(3-methoxycarbonylthiophen-2-yl)butane-1-sulfonic acid (PubChem CID 58052946) has the molecular formula C10H14O5S2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 4-(3-methoxycarbonylthiophen-2-yl)butane-1-sulfonic acid.
| Compound Name | 4-(3-methoxycarbonylthiophen-2-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58052946 |
| Molecular Formula | C10H14O5S2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 4-(3-methoxycarbonylthiophen-2-yl)butane-1-sulfonic acid |
| SMILES | COC(=O)c1ccsc1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C10H14O5S2/c1-15-10(11)8-5-6-16-9(8)4-2-3-7-17(12,13)14/h5-6H,2-4,7H2,1H3,(H,12,13,14) |
| InChIKey | LPWYHQFDAVXSQQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|