C18H15N5O4S — CID 58053321
(5S)-5-imidazo[2,1-b][1,3]thiazol-6-yl-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 58053321) has the molecular formula C18H15N5O4S and a molecular weight of 397.42 g/mol. Its IUPAC name is (5S)-5-imidazo[2,1-b][1,3]thiazol-6-yl-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-imidazo[2,1-b][1,3]thiazol-6-yl-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58053321 |
| Molecular Formula | C18H15N5O4S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (5S)-5-imidazo[2,1-b][1,3]thiazol-6-yl-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3cn4ccsc4n3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C18H15N5O4S/c1-27-11-3-2-10-7-23(14(24)12(10)6-11)9-18(15(25)20-16(26)21-18)13-8-22-4-5-28-17(22)19-13/h2-6,8H,7,9H2,1H3,(H2,20,21,25,26)/t18-/m0/s1 |
| InChIKey | JQHGTDFKNLFURA-SFHVURJKSA-N |
| XLogP | 1.10 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|