C24H21N3O5 — CID 58053350
(3R)-3-(5-cyclopropylfuro[3,2-b]pyridin-2-yl)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 58053350) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is (3R)-3-(5-cyclopropylfuro[3,2-b]pyridin-2-yl)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(5-cyclopropylfuro[3,2-b]pyridin-2-yl)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58053350 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (3R)-3-(5-cyclopropylfuro[3,2-b]pyridin-2-yl)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3cc4nc(C5CC5)ccc4o3)CC(=O)NC1=O)C2 |
| InChI | InChI=1S/C24H21N3O5/c1-31-15-5-4-14-11-27(22(29)16(14)8-15)12-24(10-21(28)26-23(24)30)20-9-18-19(32-20)7-6-17(25-18)13-2-3-13/h4-9,13H,2-3,10-12H2,1H3,(H,26,28,30)/t24-/m1/s1 |
| InChIKey | BXWYAGGZMORNKM-XMMPIXPASA-N |
| XLogP | 2.65 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|