C25H20N4O5 — CID 58053862
(3R)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-[5-(1H-pyrazol-5-yl)-1-benzofuran-2-yl]pyrrolidine-2,5-dione (PubChem CID 58053862) has the molecular formula C25H20N4O5 and a molecular weight of 456.46 g/mol. Its IUPAC name is (3R)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-[5-(1H-pyrazol-5-yl)-1-benzofuran-2-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-[5-(1H-pyrazol-5-yl)-1-benzofuran-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58053862 |
| Molecular Formula | C25H20N4O5 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (3R)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-[5-(1H-pyrazol-5-yl)-1-benzofuran-2-yl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3cc4cc(-c5ccn[nH]5)ccc4o3)CC(=O)NC1=O)C2 |
| InChI | InChI=1S/C25H20N4O5/c1-33-17-4-2-15-12-29(23(31)18(15)10-17)13-25(11-22(30)27-24(25)32)21-9-16-8-14(3-5-20(16)34-21)19-6-7-26-28-19/h2-10H,11-13H2,1H3,(H,26,28)(H,27,30,32)/t25-/m1/s1 |
| InChIKey | WBBHKANVOZWOLI-RUZDIDTESA-N |
| XLogP | 2.77 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|