C25H22N2O6 — CID 143990464
2-[3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,7-dioxoazepan-3-yl]-1-benzofuran-5-carbaldehyde (PubChem CID 143990464) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-[3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,7-dioxoazepan-3-yl]-1-benzofuran-5-carbaldehyde.
| Compound Name | 2-[3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,7-dioxoazepan-3-yl]-1-benzofuran-5-carbaldehyde |
|---|---|
| PubChem CID | 143990464 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-[3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,7-dioxoazepan-3-yl]-1-benzofuran-5-carbaldehyde |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(c3cc4cc(C=O)ccc4o3)CCCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C25H22N2O6/c1-32-18-6-5-16-12-27(23(30)19(16)11-18)14-25(8-2-3-22(29)26-24(25)31)21-10-17-9-15(13-28)4-7-20(17)33-21/h4-7,9-11,13H,2-3,8,12,14H2,1H3,(H,26,29,31) |
| InChIKey | JVFDLGZUHKZNIH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|