C28H29FN4O6 — CID 58053737
6-fluoro-2-[(3R)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(propan-2-ylamino)ethyl]-1-benzofuran-5-carboxamide (PubChem CID 58053737) has the molecular formula C28H29FN4O6 and a molecular weight of 536.56 g/mol. Its IUPAC name is 6-fluoro-2-[(3R)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(propan-2-ylamino)ethyl]-1-benzofuran-5-carboxamide.
| Compound Name | 6-fluoro-2-[(3R)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(propan-2-ylamino)ethyl]-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 58053737 |
| Molecular Formula | C28H29FN4O6 |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 6-fluoro-2-[(3R)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxopyrrolidin-3-yl]-N-[2-(propan-2-ylamino)ethyl]-1-benzofuran-5-carboxamide |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3cc4cc(C(=O)NCCNC(C)C)c(F)cc4o3)CC(=O)NC1=O)C2 |
| InChI | InChI=1S/C28H29FN4O6/c1-15(2)30-6-7-31-25(35)20-8-17-9-23(39-22(17)11-21(20)29)28(12-24(34)32-27(28)37)14-33-13-16-4-5-18(38-3)10-19(16)26(33)36/h4-5,8-11,15,30H,6-7,12-14H2,1-3H3,(H,31,35)(H,32,34,37)/t28-/m1/s1 |
| InChIKey | NZTNMXUMZSXCHE-MUUNZHRXSA-N |
| XLogP | 2.25 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|