C16H16FN3O2 — CID 58054511
1-[(3-fluoro-4-methoxyphenyl)methyl]-4-methoxyindazol-3-amine (PubChem CID 58054511) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methoxyphenyl)methyl]-4-methoxyindazol-3-amine.
| Compound Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]-4-methoxyindazol-3-amine |
|---|---|
| PubChem CID | 58054511 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]-4-methoxyindazol-3-amine |
| SMILES | COc1ccc(Cn2nc(N)c3c(OC)cccc32)cc1F |
| InChI | InChI=1S/C16H16FN3O2/c1-21-13-7-6-10(8-11(13)17)9-20-12-4-3-5-14(22-2)15(12)16(18)19-20/h3-8H,9H2,1-2H3,(H2,18,19) |
| InChIKey | PFMNBWVAHZPKKL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |