C29H35N5O5 — CID 58056735
(2R)-2-methyl-N-[(1S)-2-[(2S)-2-[8-(4-nitrophenyl)imidazo[1,2-a]pyridin-2-yl]pyrrolidin-1-yl]-1-(oxan-4-yl)-2-oxoethyl]butanamide (PubChem CID 58056735) has the molecular formula C29H35N5O5 and a molecular weight of 533.63 g/mol. Its IUPAC name is (2R)-2-methyl-N-[(1S)-2-[(2S)-2-[8-(4-nitrophenyl)imidazo[1,2-a]pyridin-2-yl]pyrrolidin-1-yl]-1-(oxan-4-yl)-2-oxoethyl]butanamide.
| Compound Name | (2R)-2-methyl-N-[(1S)-2-[(2S)-2-[8-(4-nitrophenyl)imidazo[1,2-a]pyridin-2-yl]pyrrolidin-1-yl]-1-(oxan-4-yl)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 58056735 |
| Molecular Formula | C29H35N5O5 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | (2R)-2-methyl-N-[(1S)-2-[(2S)-2-[8-(4-nitrophenyl)imidazo[1,2-a]pyridin-2-yl]pyrrolidin-1-yl]-1-(oxan-4-yl)-2-oxoethyl]butanamide |
| SMILES | CC[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1c1cn2cccc(-c3ccc([N+](=O)[O-])cc3)c2n1)C1CCOCC1 |
| InChI | InChI=1S/C29H35N5O5/c1-3-19(2)28(35)31-26(21-12-16-39-17-13-21)29(36)33-15-5-7-25(33)24-18-32-14-4-6-23(27(32)30-24)20-8-10-22(11-9-20)34(37)38/h4,6,8-11,14,18-19,21,25-26H,3,5,7,12-13,15-17H2,1-2H3,(H,31,35)/t19-,25+,26+/m1/s1 |
| InChIKey | YTRVKWDUQMEBSR-PBXQCXKZSA-N |
| XLogP | 4.53 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|