C20H24ClFN6 — CID 58057856
4-chloro-5-fluoro-7-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]pyrrolo[2,3-d]pyrimidine (PubChem CID 58057856) has the molecular formula C20H24ClFN6 and a molecular weight of 402.91 g/mol. Its IUPAC name is 4-chloro-5-fluoro-7-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-chloro-5-fluoro-7-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 58057856 |
| Molecular Formula | C20H24ClFN6 |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-chloro-5-fluoro-7-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]pyrrolo[2,3-d]pyrimidine |
| SMILES | CCCCCc1cnc(N2CCC(n3cc(F)c4c(Cl)ncnc43)CC2)nc1 |
| InChI | InChI=1S/C20H24ClFN6/c1-2-3-4-5-14-10-23-20(24-11-14)27-8-6-15(7-9-27)28-12-16(22)17-18(21)25-13-26-19(17)28/h10-13,15H,2-9H2,1H3 |
| InChIKey | SDWHOEDVKIWQTA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|