C16HV- — CID 58058429
hexadeca-1,3,5,7,9,11,13,15-octayne;vanadium (PubChem CID 58058429) has the molecular formula C16HV- and a molecular weight of 244.13 g/mol. Its IUPAC name is hexadeca-1,3,5,7,9,11,13,15-octayne;vanadium.
| Compound Name | hexadeca-1,3,5,7,9,11,13,15-octayne;vanadium |
|---|---|
| PubChem CID | 58058429 |
| Molecular Formula | C16HV- |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | hexadeca-1,3,5,7,9,11,13,15-octayne;vanadium |
| SMILES | [C-]#CC#CC#CC#CC#CC#CC#CC#C.[V] |
| InChI | InChI=1S/C16H.V/c1-3-5-7-9-11-13-15-16-14-12-10-8-6-4-2;/h1H;/q-1; |
| InChIKey | MXLLPNUPMIFWML-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|