C30H10NO- — CID 18714099
N-methyl-N-[(Z)-14-methylhexacos-13-en-1,3,5,7,9,11,15,17,19,21,23,25-dodecayn-13-yl]acetamide (PubChem CID 18714099) has the molecular formula C30H10NO- and a molecular weight of 400.42 g/mol. Its IUPAC name is N-methyl-N-[(Z)-14-methylhexacos-13-en-1,3,5,7,9,11,15,17,19,21,23,25-dodecayn-13-yl]acetamide.
| Compound Name | N-methyl-N-[(Z)-14-methylhexacos-13-en-1,3,5,7,9,11,15,17,19,21,23,25-dodecayn-13-yl]acetamide |
|---|---|
| PubChem CID | 18714099 |
| Molecular Formula | C30H10NO- |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-methyl-N-[(Z)-14-methylhexacos-13-en-1,3,5,7,9,11,15,17,19,21,23,25-dodecayn-13-yl]acetamide |
| SMILES | [C-]#CC#CC#CC#CC#CC#C/C(=C(\C)C#CC#CC#CC#CC#CC#C)N(C)C(C)=O |
| InChI | InChI=1S/C30H10NO/c1-6-8-10-12-14-16-18-20-22-24-26-28(3)30(31(5)29(4)32)27-25-23-21-19-17-15-13-11-9-7-2/h1H,3-5H3/q-1/b30-28- |
| InChIKey | PSPRBVNUVHALEW-HYOGKJQXSA-N |
| XLogP | 1.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|