C21H38O4 — CID 160973297
[(2S)-1-hydroxy-5-oxohexan-2-yl] pentadeca-2,4,6,8,10,12,14-heptaynoate;molecular hydrogen (PubChem CID 160973297) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is [(2S)-1-hydroxy-5-oxohexan-2-yl] pentadeca-2,4,6,8,10,12,14-heptaynoate;molecular hydrogen.
| Compound Name | [(2S)-1-hydroxy-5-oxohexan-2-yl] pentadeca-2,4,6,8,10,12,14-heptaynoate;molecular hydrogen |
|---|---|
| PubChem CID | 160973297 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | [(2S)-1-hydroxy-5-oxohexan-2-yl] pentadeca-2,4,6,8,10,12,14-heptaynoate;molecular hydrogen |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC(=O)O[C@H](CO)CCC(C)=O.[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C21H12O4.13H2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-21(24)25-20(18-22)17-16-19(2)23;;;;;;;;;;;;;/h1,20,22H,16-18H2,2H3;13*1H/t20-;;;;;;;;;;;;;/m0............./s1 |
| InChIKey | SYNQYCBQEKHRJI-JHJPUMIDSA-N |
| XLogP | 3.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|