C34H11O8P — CID 59521540
[(2R)-1-phosphonooxy-3-tetradeca-2,4,6,8,10,12-hexaynoyloxypropan-2-yl] heptadeca-2,4,6,8,10,12,14,16-octaynoate (PubChem CID 59521540) has the molecular formula C34H11O8P and a molecular weight of 578.43 g/mol. Its IUPAC name is [(2R)-1-phosphonooxy-3-tetradeca-2,4,6,8,10,12-hexaynoyloxypropan-2-yl] heptadeca-2,4,6,8,10,12,14,16-octaynoate.
| Compound Name | [(2R)-1-phosphonooxy-3-tetradeca-2,4,6,8,10,12-hexaynoyloxypropan-2-yl] heptadeca-2,4,6,8,10,12,14,16-octaynoate |
|---|---|
| PubChem CID | 59521540 |
| Molecular Formula | C34H11O8P |
| Molecular Weight | 578.43 g/mol |
| Exact Mass | 578.02 |
| IUPAC Name | [(2R)-1-phosphonooxy-3-tetradeca-2,4,6,8,10,12-hexaynoyloxypropan-2-yl] heptadeca-2,4,6,8,10,12,14,16-octaynoate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC(=O)O[C@H](COC(=O)C#CC#CC#CC#CC#CC#CC)COP(=O)(O)O |
| InChI | InChI=1S/C34H11O8P/c1-3-5-7-9-11-13-15-16-17-19-21-23-25-27-29-34(36)42-32(31-41-43(37,38)39)30-40-33(35)28-26-24-22-20-18-14-12-10-8-6-4-2/h1,32H,30-31H2,2H3,(H2,37,38,39)/t32-/m1/s1 |
| InChIKey | VJVJKMWQJLRQAF-JGCGQSQUSA-N |
| XLogP | -0.75 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.43 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|