C28H9Na2O8P — CID 59521531
disodium;[(2R)-2-deca-2,4,6,8-tetraynoyloxy-3-pentadeca-2,4,6,8,10,12,14-heptaynoyloxypropyl] phosphate (PubChem CID 59521531) has the molecular formula C28H9Na2O8P and a molecular weight of 550.33 g/mol. Its IUPAC name is disodium;[(2R)-2-deca-2,4,6,8-tetraynoyloxy-3-pentadeca-2,4,6,8,10,12,14-heptaynoyloxypropyl] phosphate.
| Compound Name | disodium;[(2R)-2-deca-2,4,6,8-tetraynoyloxy-3-pentadeca-2,4,6,8,10,12,14-heptaynoyloxypropyl] phosphate |
|---|---|
| PubChem CID | 59521531 |
| Molecular Formula | C28H9Na2O8P |
| Molecular Weight | 550.33 g/mol |
| Exact Mass | 549.98 |
| IUPAC Name | disodium;[(2R)-2-deca-2,4,6,8-tetraynoyloxy-3-pentadeca-2,4,6,8,10,12,14-heptaynoyloxypropyl] phosphate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC(=O)OC[C@H](COP(=O)([O-])[O-])OC(=O)C#CC#CC#CC#CC.[Na+].[Na+] |
| InChI | InChI=1S/C28H11O8P.2Na/c1-3-5-7-9-11-12-13-14-15-17-18-20-22-27(29)34-24-26(25-35-37(31,32)33)36-28(30)23-21-19-16-10-8-6-4-2;;/h1,26H,24-25H2,2H3,(H2,31,32,33);;/q;2*+1/p-2/t26-;;/m1../s1 |
| InChIKey | ROLIHEZHLNSGOD-FBHGDYMESA-L |
| XLogP | -8.02 |
| TPSA | 125.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.33 |
| LogP ≤ 5 | -8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|