C17H11O8P — CID 59521212
[(2S)-1-(hydroxymethoxy)-3-phosphonooxypropan-2-yl] trideca-2,4,6,8,10,12-hexaynoate (PubChem CID 59521212) has the molecular formula C17H11O8P and a molecular weight of 374.24 g/mol. Its IUPAC name is [(2S)-1-(hydroxymethoxy)-3-phosphonooxypropan-2-yl] trideca-2,4,6,8,10,12-hexaynoate.
| Compound Name | [(2S)-1-(hydroxymethoxy)-3-phosphonooxypropan-2-yl] trideca-2,4,6,8,10,12-hexaynoate |
|---|---|
| PubChem CID | 59521212 |
| Molecular Formula | C17H11O8P |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | [(2S)-1-(hydroxymethoxy)-3-phosphonooxypropan-2-yl] trideca-2,4,6,8,10,12-hexaynoate |
| SMILES | C#CC#CC#CC#CC#CC#CC(=O)O[C@@H](COCO)COP(=O)(O)O |
| InChI | InChI=1S/C17H11O8P/c1-2-3-4-5-6-7-8-9-10-11-12-17(19)25-16(13-23-15-18)14-24-26(20,21)22/h1,16,18H,13-15H2,(H2,20,21,22)/t16-/m0/s1 |
| InChIKey | PTRBBLFRLLUKME-INIZCTEOSA-N |
| XLogP | -1.38 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|