C19H10O5 — CID 59520714
[(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadeca-2,4,6,8,10,12,14-heptaynoate (PubChem CID 59520714) has the molecular formula C19H10O5 and a molecular weight of 318.28 g/mol. Its IUPAC name is [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadeca-2,4,6,8,10,12,14-heptaynoate.
| Compound Name | [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadeca-2,4,6,8,10,12,14-heptaynoate |
|---|---|
| PubChem CID | 59520714 |
| Molecular Formula | C19H10O5 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] pentadeca-2,4,6,8,10,12,14-heptaynoate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC(=O)O[C@H](CO)COCO |
| InChI | InChI=1S/C19H10O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19(22)24-18(15-20)16-23-17-21/h1,18,20-21H,15-17H2/t18-/m1/s1 |
| InChIKey | CYHXLJBYWMCRRO-GOSISDBHSA-N |
| XLogP | -1.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|