C27H13NO — CID 167639948
N-ethylacetamide;tricosa-1,3,5,7,9,11,13,15,17,19,21-undecayne (PubChem CID 167639948) has the molecular formula C27H13NO and a molecular weight of 367.41 g/mol. Its IUPAC name is N-ethylacetamide;tricosa-1,3,5,7,9,11,13,15,17,19,21-undecayne.
| Compound Name | N-ethylacetamide;tricosa-1,3,5,7,9,11,13,15,17,19,21-undecayne |
|---|---|
| PubChem CID | 167639948 |
| Molecular Formula | C27H13NO |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-ethylacetamide;tricosa-1,3,5,7,9,11,13,15,17,19,21-undecayne |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC.CCNC(C)=O |
| InChI | InChI=1S/C23H4.C4H9NO/c1-3-5-7-9-11-13-15-17-19-21-23-22-20-18-16-14-12-10-8-6-4-2;1-3-5-4(2)6/h1H,2H3;3H2,1-2H3,(H,5,6) |
| InChIKey | PAKJFRSDVNJQKP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|