C21H18Cl2N4O6 — CID 58059720
[4-[2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethoxymethyl]phenyl]-(4-nitrophenyl)methanone (PubChem CID 58059720) has the molecular formula C21H18Cl2N4O6 and a molecular weight of 493.30 g/mol. Its IUPAC name is [4-[2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethoxymethyl]phenyl]-(4-nitrophenyl)methanone.
| Compound Name | [4-[2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethoxymethyl]phenyl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 58059720 |
| Molecular Formula | C21H18Cl2N4O6 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | [4-[2-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethoxy]ethoxymethyl]phenyl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(COCCOCCOc2nc(Cl)nc(Cl)n2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18Cl2N4O6/c22-19-24-20(23)26-21(25-19)33-12-11-31-9-10-32-13-14-1-3-15(4-2-14)18(28)16-5-7-17(8-6-16)27(29)30/h1-8H,9-13H2 |
| InChIKey | XLFSOFCDVCTNRJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 126.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|