C18H22F2O5 — CID 58060794
[(2R,4aR,7S)-8,8-difluoro-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate (PubChem CID 58060794) has the molecular formula C18H22F2O5 and a molecular weight of 356.37 g/mol. Its IUPAC name is [(2R,4aR,7S)-8,8-difluoro-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,4aR,7S)-8,8-difluoro-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58060794 |
| Molecular Formula | C18H22F2O5 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [(2R,4aR,7S)-8,8-difluoro-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1CO[C@@H]2CO[C@@H](c3ccccc3)OC2C1(F)F |
| InChI | InChI=1S/C18H22F2O5/c1-17(2,3)16(21)24-13-10-22-12-9-23-15(11-7-5-4-6-8-11)25-14(12)18(13,19)20/h4-8,12-15H,9-10H2,1-3H3/t12-,13+,14?,15-/m1/s1 |
| InChIKey | ORUVJSGZXAPRAX-IZGVIRRGSA-N |
| XLogP | 3.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |