C20H19FO3 — CID 58061168
2-[2-ethyl-5-(4-fluorophenoxy)phenyl]-3-hydroxycyclohex-2-en-1-one (PubChem CID 58061168) has the molecular formula C20H19FO3 and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-[2-ethyl-5-(4-fluorophenoxy)phenyl]-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-[2-ethyl-5-(4-fluorophenoxy)phenyl]-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 58061168 |
| Molecular Formula | C20H19FO3 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[2-ethyl-5-(4-fluorophenoxy)phenyl]-3-hydroxycyclohex-2-en-1-one |
| SMILES | CCc1ccc(Oc2ccc(F)cc2)cc1C1=C(O)CCCC1=O |
| InChI | InChI=1S/C20H19FO3/c1-2-13-6-9-16(24-15-10-7-14(21)8-11-15)12-17(13)20-18(22)4-3-5-19(20)23/h6-12,22H,2-5H2,1H3 |
| InChIKey | DJOXKCOSUNLLGY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |