C19H17ClO3 — CID 58061466
2-[5-(4-chlorophenoxy)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one (PubChem CID 58061466) has the molecular formula C19H17ClO3 and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-[5-(4-chlorophenoxy)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one.
| Compound Name | 2-[5-(4-chlorophenoxy)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 58061466 |
| Molecular Formula | C19H17ClO3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-[5-(4-chlorophenoxy)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one |
| SMILES | CCc1ccc(Oc2ccc(Cl)cc2)cc1C1=C(O)CCC1=O |
| InChI | InChI=1S/C19H17ClO3/c1-2-12-3-6-15(23-14-7-4-13(20)5-8-14)11-16(12)19-17(21)9-10-18(19)22/h3-8,11,21H,2,9-10H2,1H3 |
| InChIKey | YZZJWJHBNZSYKJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |