C20H19ClO2 — CID 58502799
2-[5-(4-chloro-2-methylphenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one (PubChem CID 58502799) has the molecular formula C20H19ClO2 and a molecular weight of 326.82 g/mol. Its IUPAC name is 2-[5-(4-chloro-2-methylphenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one.
| Compound Name | 2-[5-(4-chloro-2-methylphenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 58502799 |
| Molecular Formula | C20H19ClO2 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[5-(4-chloro-2-methylphenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2C)cc1C1=C(O)CCC1=O |
| InChI | InChI=1S/C20H19ClO2/c1-3-13-4-5-14(16-7-6-15(21)10-12(16)2)11-17(13)20-18(22)8-9-19(20)23/h4-7,10-11,22H,3,8-9H2,1-2H3 |
| InChIKey | SHQZGXVDRBBVDI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |