C23H14ClFO3 — CID 129147426
4-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-5-hydroxy-10-oxatricyclo[5.2.1.02,6]deca-1,4,6,8-tetraen-3-one (PubChem CID 129147426) has the molecular formula C23H14ClFO3 and a molecular weight of 392.81 g/mol. Its IUPAC name is 4-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-5-hydroxy-10-oxatricyclo[5.2.1.02,6]deca-1,4,6,8-tetraen-3-one.
| Compound Name | 4-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-5-hydroxy-10-oxatricyclo[5.2.1.02,6]deca-1,4,6,8-tetraen-3-one |
|---|---|
| PubChem CID | 129147426 |
| Molecular Formula | C23H14ClFO3 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 4-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-5-hydroxy-10-oxatricyclo[5.2.1.02,6]deca-1,4,6,8-tetraen-3-one |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2F)cc1C1=C(O)c2c(c3ccc2o3)C1=O |
| InChI | InChI=1S/C23H14ClFO3/c1-2-11-3-4-12(14-6-5-13(24)10-16(14)25)9-15(11)19-22(26)20-17-7-8-18(28-17)21(20)23(19)27/h3-10,26H,2H2,1H3 |
| InChIKey | WTVSSAIZYIODDF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|