C22H23F2NO4 — CID 58061403
4-[5-[(4,6-difluoro-2-pyridinyl)oxy]-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one (PubChem CID 58061403) has the molecular formula C22H23F2NO4 and a molecular weight of 403.43 g/mol. Its IUPAC name is 4-[5-[(4,6-difluoro-2-pyridinyl)oxy]-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one.
| Compound Name | 4-[5-[(4,6-difluoro-2-pyridinyl)oxy]-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one |
|---|---|
| PubChem CID | 58061403 |
| Molecular Formula | C22H23F2NO4 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-[5-[(4,6-difluoro-2-pyridinyl)oxy]-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one |
| SMILES | CCc1ccc(Oc2cc(F)cc(F)n2)cc1C1=C(O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C22H23F2NO4/c1-6-12-7-8-14(28-17-10-13(23)9-16(24)25-17)11-15(12)18-19(26)21(2,3)29-22(4,5)20(18)27/h7-11,26H,6H2,1-5H3 |
| InChIKey | UTBAQXHGSSKSRF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|