C24H24N2O6 — CID 58061170
4-[4-ethyl-3-(3-hydroxy-2,2,6,6-tetramethyl-5-oxopyran-4-yl)phenoxy]-2-nitrobenzonitrile (PubChem CID 58061170) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 4-[4-ethyl-3-(3-hydroxy-2,2,6,6-tetramethyl-5-oxopyran-4-yl)phenoxy]-2-nitrobenzonitrile.
| Compound Name | 4-[4-ethyl-3-(3-hydroxy-2,2,6,6-tetramethyl-5-oxopyran-4-yl)phenoxy]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 58061170 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-[4-ethyl-3-(3-hydroxy-2,2,6,6-tetramethyl-5-oxopyran-4-yl)phenoxy]-2-nitrobenzonitrile |
| SMILES | CCc1ccc(Oc2ccc(C#N)c([N+](=O)[O-])c2)cc1C1=C(O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C24H24N2O6/c1-6-14-7-9-16(31-17-10-8-15(13-25)19(12-17)26(29)30)11-18(14)20-21(27)23(2,3)32-24(4,5)22(20)28/h7-12,27H,6H2,1-5H3 |
| InChIKey | MUIJGGUSKFGLGI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|