C24H26ClNO6 — CID 58061127
4-[5-(5-chloro-2-methyl-4-nitrophenoxy)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one (PubChem CID 58061127) has the molecular formula C24H26ClNO6 and a molecular weight of 459.93 g/mol. Its IUPAC name is 4-[5-(5-chloro-2-methyl-4-nitrophenoxy)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one.
| Compound Name | 4-[5-(5-chloro-2-methyl-4-nitrophenoxy)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one |
|---|---|
| PubChem CID | 58061127 |
| Molecular Formula | C24H26ClNO6 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 4-[5-(5-chloro-2-methyl-4-nitrophenoxy)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one |
| SMILES | CCc1ccc(Oc2cc(Cl)c([N+](=O)[O-])cc2C)cc1C1=C(O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C24H26ClNO6/c1-7-14-8-9-15(31-19-12-17(25)18(26(29)30)10-13(19)2)11-16(14)20-21(27)23(3,4)32-24(5,6)22(20)28/h8-12,27H,7H2,1-6H3 |
| InChIKey | ALLLIVXYUGZXMX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|