C28H22N3O4+ — CID 58064838
[3-(3H-benzimidazol-5-yl)-1-methoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium-2-yl]methanol (PubChem CID 58064838) has the molecular formula C28H22N3O4+ and a molecular weight of 464.50 g/mol. Its IUPAC name is [3-(3H-benzimidazol-5-yl)-1-methoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium-2-yl]methanol.
| Compound Name | [3-(3H-benzimidazol-5-yl)-1-methoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium-2-yl]methanol |
|---|---|
| PubChem CID | 58064838 |
| Molecular Formula | C28H22N3O4+ |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [3-(3H-benzimidazol-5-yl)-1-methoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium-2-yl]methanol |
| SMILES | COc1c(CO)c(-c2ccc3nc[nH]c3c2)cc2c1c[n+](C)c1c3cc4c(cc3ccc21)OCO4 |
| InChI | InChI=1S/C28H21N3O4/c1-31-11-21-20(17-5-3-16-8-25-26(35-14-34-25)10-19(16)27(17)31)9-18(22(12-32)28(21)33-2)15-4-6-23-24(7-15)30-13-29-23/h3-11,13,32H,12,14H2,1-2H3/p+1 |
| InChIKey | UNMNZVCULVWDTE-UHFFFAOYSA-O |
| XLogP | 4.74 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|