C27H18N3O4+ — CID 58065002
15-(3H-benzimidazol-5-yl)-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene (PubChem CID 58065002) has the molecular formula C27H18N3O4+ and a molecular weight of 448.46 g/mol. Its IUPAC name is 15-(3H-benzimidazol-5-yl)-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene.
| Compound Name | 15-(3H-benzimidazol-5-yl)-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene |
|---|---|
| PubChem CID | 58065002 |
| Molecular Formula | C27H18N3O4+ |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 15-(3H-benzimidazol-5-yl)-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene |
| SMILES | C[n+]1cc2c3c(cc(-c4ccc5nc[nH]c5c4)c2c2ccc4cc5c(cc4c21)OCO5)OCO3 |
| InChI | InChI=1S/C27H18N3O4/c1-30-10-19-25(16-4-2-15-7-22-23(32-12-31-22)9-18(15)26(16)30)17(8-24-27(19)34-13-33-24)14-3-5-20-21(6-14)29-11-28-20/h2-11H,12-13H2,1H3,(H,28,29)/q+1 |
| InChIKey | IQXPKZIDHFMBME-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|