C9H14O — CID 58065052
(1S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one (PubChem CID 58065052) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (1S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one.
| Compound Name | (1S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
|---|---|
| PubChem CID | 58065052 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (1S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
| SMILES | CC1(C)C2CCC(=O)[C@H]1C2 |
| InChI | InChI=1S/C9H14O/c1-9(2)6-3-4-8(10)7(9)5-6/h6-7H,3-5H2,1-2H3/t6?,7-/m1/s1 |
| InChIKey | XZFDKWMYCUEKSS-COBSHVIPSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |