C9H7N2O2+ — CID 58066007
methyl 1,2-dihydropyrrolo[2,3-b]pyridin-2-ylium-5-carboxylate (PubChem CID 58066007) has the molecular formula C9H7N2O2+ and a molecular weight of 175.17 g/mol. Its IUPAC name is methyl 1,2-dihydropyrrolo[2,3-b]pyridin-2-ylium-5-carboxylate.
| Compound Name | methyl 1,2-dihydropyrrolo[2,3-b]pyridin-2-ylium-5-carboxylate |
|---|---|
| PubChem CID | 58066007 |
| Molecular Formula | C9H7N2O2+ |
| Molecular Weight | 175.17 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | methyl 1,2-dihydropyrrolo[2,3-b]pyridin-2-ylium-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)C=[C+]N2 |
| InChI | InChI=1S/C9H6N2O2/c1-13-9(12)7-4-6-2-3-10-8(6)11-5-7/h2,4-5H,1H3/p+1 |
| InChIKey | IMNBTMMZHZANCR-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|