C7H5N3O2Se — CID 166001529
methyl [1,2,5]selenadiazolo[3,4-b]pyridine-6-carboxylate (PubChem CID 166001529) has the molecular formula C7H5N3O2Se and a molecular weight of 242.10 g/mol. Its IUPAC name is methyl [1,2,5]selenadiazolo[3,4-b]pyridine-6-carboxylate.
| Compound Name | methyl [1,2,5]selenadiazolo[3,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 166001529 |
| Molecular Formula | C7H5N3O2Se |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | methyl [1,2,5]selenadiazolo[3,4-b]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cnc2n[se]nc2c1 |
| InChI | InChI=1S/C7H5N3O2Se/c1-12-7(11)4-2-5-6(8-3-4)10-13-9-5/h2-3H,1H3 |
| InChIKey | XQPRWFUXLAPTNF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|