methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate

C11H9ClN2O3 — CID 142496373

IUPACmethyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate
SMILESCOC(=O)c1cnc2nc(OC)c(Cl)cc2c1
InChIInChI=1S/C11H9ClN2O3/c1-16-10-8(12)4-6-3-7(11(15)17-2)5-13-9(6)14-10/h3-5H,1-2H3
InChIKeyNCVJWTXXDYXDCL-UHFFFAOYSA-N
MW252.66 g/mol
LogP2.08
Rot. Bonds2

About methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate

methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate (PubChem CID 142496373) has the molecular formula C11H9ClN2O3 and a molecular weight of 252.66 g/mol. Its IUPAC name is methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate
PubChem CID142496373
Molecular FormulaC11H9ClN2O3
Molecular Weight252.66 g/mol
Exact Mass252.03
IUPAC Namemethyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate
SMILESCOC(=O)c1cnc2nc(OC)c(Cl)cc2c1
InChIInChI=1S/C11H9ClN2O3/c1-16-10-8(12)4-6-3-7(11(15)17-2)5-13-9(6)14-10/h3-5H,1-2H3
InChIKeyNCVJWTXXDYXDCL-UHFFFAOYSA-N
XLogP2.08
TPSA61.31 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.66
LogP ≤ 52.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate?
The IUPAC name of methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate (CID 142496373) is methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate.
What is the SMILES notation for methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate?
The canonical SMILES for methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate is COC(=O)c1cnc2nc(OC)c(Cl)cc2c1.
What is the InChIKey of methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate?
The InChIKey is NCVJWTXXDYXDCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O3/c1-16-10-8(12)4-6-3-7(11(15)17-2)5-13-9(6)14-10/h3-5H,1-2H3.
What are the key properties of methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate?
methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate has a molecular weight of 252.66 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate is sourced from PubChem (CID 142496373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).