C11H9ClN2O3 — CID 142496373
methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate (PubChem CID 142496373) has the molecular formula C11H9ClN2O3 and a molecular weight of 252.66 g/mol. Its IUPAC name is methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate.
| Compound Name | methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 142496373 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | methyl 6-chloro-7-methoxy-1,8-naphthyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc2nc(OC)c(Cl)cc2c1 |
| InChI | InChI=1S/C11H9ClN2O3/c1-16-10-8(12)4-6-3-7(11(15)17-2)5-13-9(6)14-10/h3-5H,1-2H3 |
| InChIKey | NCVJWTXXDYXDCL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |