C10H10ClN3O2 — CID 104663584
methyl 2-(1-chloroethyl)-1H-imidazo[4,5-b]pyridine-6-carboxylate (PubChem CID 104663584) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is methyl 2-(1-chloroethyl)-1H-imidazo[4,5-b]pyridine-6-carboxylate.
| Compound Name | methyl 2-(1-chloroethyl)-1H-imidazo[4,5-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 104663584 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | methyl 2-(1-chloroethyl)-1H-imidazo[4,5-b]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cnc2nc(C(C)Cl)[nH]c2c1 |
| InChI | InChI=1S/C10H10ClN3O2/c1-5(11)8-13-7-3-6(10(15)16-2)4-12-9(7)14-8/h3-5H,1-2H3,(H,12,13,14) |
| InChIKey | LSJJLXJRTSDGOM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|