C14H13ClN2O4 — CID 67256583
methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate (PubChem CID 67256583) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate.
| Compound Name | methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate |
|---|---|
| PubChem CID | 67256583 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2cnc(OC)nc2OC)c(Cl)c1 |
| InChI | InChI=1S/C14H13ClN2O4/c1-19-12-10(7-16-14(17-12)21-3)9-5-4-8(6-11(9)15)13(18)20-2/h4-7H,1-3H3 |
| InChIKey | YLMAKNSGNGEFMM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |