methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate

C14H13ClN2O4 — CID 67256583

IUPACmethyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate
SMILESCOC(=O)c1ccc(-c2cnc(OC)nc2OC)c(Cl)c1
InChIInChI=1S/C14H13ClN2O4/c1-19-12-10(7-16-14(17-12)21-3)9-5-4-8(6-11(9)15)13(18)20-2/h4-7H,1-3H3
InChIKeyYLMAKNSGNGEFMM-UHFFFAOYSA-N
MW308.72 g/mol
LogP2.60
Rot. Bonds4

About methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate

methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate (PubChem CID 67256583) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate.

Molecular Properties

Compound Namemethyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate
PubChem CID67256583
Molecular FormulaC14H13ClN2O4
Molecular Weight308.72 g/mol
Exact Mass308.06
IUPAC Namemethyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate
SMILESCOC(=O)c1ccc(-c2cnc(OC)nc2OC)c(Cl)c1
InChIInChI=1S/C14H13ClN2O4/c1-19-12-10(7-16-14(17-12)21-3)9-5-4-8(6-11(9)15)13(18)20-2/h4-7H,1-3H3
InChIKeyYLMAKNSGNGEFMM-UHFFFAOYSA-N
XLogP2.60
TPSA70.54 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.72
LogP ≤ 52.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate?
The IUPAC name of methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate (CID 67256583) is methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate.
What is the SMILES notation for methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate?
The canonical SMILES for methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate is COC(=O)c1ccc(-c2cnc(OC)nc2OC)c(Cl)c1.
What is the InChIKey of methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate?
The InChIKey is YLMAKNSGNGEFMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN2O4/c1-19-12-10(7-16-14(17-12)21-3)9-5-4-8(6-11(9)15)13(18)20-2/h4-7H,1-3H3.
What are the key properties of methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate?
methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate has a molecular weight of 308.72 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chloro-4-(2,4-dimethoxypyrimidin-5-yl)benzoate is sourced from PubChem (CID 67256583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).