C43H80N2O2 — CID 58069595
[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] N-[3-(dimethylamino)propyl]carbamate (PubChem CID 58069595) has the molecular formula C43H80N2O2 and a molecular weight of 657.12 g/mol. Its IUPAC name is [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] N-[3-(dimethylamino)propyl]carbamate.
| Compound Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] N-[3-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 58069595 |
| Molecular Formula | C43H80N2O2 |
| Molecular Weight | 657.12 g/mol |
| Exact Mass | 656.62 |
| IUPAC Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] N-[3-(dimethylamino)propyl]carbamate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)NCCCN(C)C |
| InChI | InChI=1S/C43H80N2O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-42(47-43(46)44-40-37-41-45(3)4)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42H,5-12,17-18,23-41H2,1-4H3,(H,44,46)/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | UDETUYXXVIQAHP-KWXKLSQISA-N |
| XLogP | 13.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.12 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|