C41H67NO6 — CID 58070143
bis[(Z)-non-2-enyl] (2Z,5Z,11Z,14Z)-9-[4-(dimethylamino)butanoyloxy]heptadeca-2,5,11,14-tetraenedioate (PubChem CID 58070143) has the molecular formula C41H67NO6 and a molecular weight of 669.99 g/mol. Its IUPAC name is bis[(Z)-non-2-enyl] (2Z,5Z,11Z,14Z)-9-[4-(dimethylamino)butanoyloxy]heptadeca-2,5,11,14-tetraenedioate.
| Compound Name | bis[(Z)-non-2-enyl] (2Z,5Z,11Z,14Z)-9-[4-(dimethylamino)butanoyloxy]heptadeca-2,5,11,14-tetraenedioate |
|---|---|
| PubChem CID | 58070143 |
| Molecular Formula | C41H67NO6 |
| Molecular Weight | 669.99 g/mol |
| Exact Mass | 669.50 |
| IUPAC Name | bis[(Z)-non-2-enyl] (2Z,5Z,11Z,14Z)-9-[4-(dimethylamino)butanoyloxy]heptadeca-2,5,11,14-tetraenedioate |
| SMILES | CCCCCC/C=C\COC(=O)/C=C\C/C=C\CCC(C/C=C\C/C=C\CC(=O)OC/C=C\CCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C41H67NO6/c1-5-7-9-11-13-21-27-36-46-39(43)32-25-19-15-17-23-30-38(48-41(45)34-29-35-42(3)4)31-24-18-16-20-26-33-40(44)47-37-28-22-14-12-10-8-6-2/h15,17-18,20-22,24-28,32,38H,5-14,16,19,23,29-31,33-37H2,1-4H3/b17-15-,24-18-,26-20-,27-21-,28-22-,32-25- |
| InChIKey | WGWPCIBTEBNDOL-LKGLVPAESA-N |
| XLogP | 9.94 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.99 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|