C17H30N2O6S — CID 58070751
2-[[7-amino-7-formyloxy-4-oxo-2-(2-sulfanylethyl)heptanoyl]amino]heptanoic acid (PubChem CID 58070751) has the molecular formula C17H30N2O6S and a molecular weight of 390.50 g/mol. Its IUPAC name is 2-[[7-amino-7-formyloxy-4-oxo-2-(2-sulfanylethyl)heptanoyl]amino]heptanoic acid.
| Compound Name | 2-[[7-amino-7-formyloxy-4-oxo-2-(2-sulfanylethyl)heptanoyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 58070751 |
| Molecular Formula | C17H30N2O6S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-[[7-amino-7-formyloxy-4-oxo-2-(2-sulfanylethyl)heptanoyl]amino]heptanoic acid |
| SMILES | CCCCCC(NC(=O)C(CCS)CC(=O)CCC(N)OC=O)C(=O)O |
| InChI | InChI=1S/C17H30N2O6S/c1-2-3-4-5-14(17(23)24)19-16(22)12(8-9-26)10-13(21)6-7-15(18)25-11-20/h11-12,14-15,26H,2-10,18H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | WNUSOZCNYJTJSC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|