About 1-aminooctyl formate
1-aminooctyl formate (PubChem CID 174824755) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-aminooctyl formate.
Molecular Properties
| Compound Name | 1-aminooctyl formate |
| PubChem CID | 174824755 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 1-aminooctyl formate |
| SMILES | CCCCCCCC(N)OC=O |
| InChI | InChI=1S/C9H19NO2/c1-2-3-4-5-6-7-9(10)12-8-11/h8-9H,2-7,10H2,1H3 |
| InChIKey | ZWCZXRJORPGYNK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminooctyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminooctyl formate?
The IUPAC name of 1-aminooctyl formate (CID 174824755) is 1-aminooctyl formate.
What is the SMILES notation for 1-aminooctyl formate?
The canonical SMILES for 1-aminooctyl formate is CCCCCCCC(N)OC=O.
What is the InChIKey of 1-aminooctyl formate?
The InChIKey is ZWCZXRJORPGYNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-2-3-4-5-6-7-9(10)12-8-11/h8-9H,2-7,10H2,1H3.
What are the key properties of 1-aminooctyl formate?
1-aminooctyl formate has a molecular weight of 173.26 g/mol, XLogP of 1.80, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminooctyl formate is sourced from PubChem (CID 174824755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).